CAS 904817-89-6
:1-[[6-nitro-2-(2-thienyl)imidazo[3,2-a]pyridin-3-yl]methyl]piperidine-4-carboxylic acid
Description:
1-[[6-nitro-2-(2-thienyl)imidazo[3,2-a]pyridin-3-yl]methyl]piperidine-4-carboxylic acid is a complex organic compound characterized by its unique structural features, which include a piperidine ring, an imidazopyridine moiety, and a nitro group. The presence of the thienyl group contributes to its aromatic properties, while the carboxylic acid functional group indicates potential for hydrogen bonding and reactivity in various chemical environments. This compound is likely to exhibit biological activity due to its intricate structure, which may interact with specific biological targets. Its molecular weight, solubility, and stability can vary depending on the conditions, but such compounds are often studied for their pharmacological properties. The CAS number 904817-89-6 serves as a unique identifier for this substance, facilitating its recognition in scientific literature and databases. Overall, this compound represents a class of molecules that may have applications in medicinal chemistry and drug development, particularly in the context of targeting specific biological pathways.
Formula:C18H18N4O4S
InChI:InChI=1/C18H18N4O4S/c23-18(24)12-5-7-20(8-6-12)11-14-17(15-2-1-9-27-15)19-16-4-3-13(22(25)26)10-21(14)16/h1-4,9-10,12H,5-8,11H2,(H,23,24)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.