CymitQuimica logo

CAS 904817-98-7

:

1-[[2-(2-furyl)-6-nitro-imidazo[3,2-a]pyridin-3-yl]methyl]piperidine-4-carboxylic acid

Description:
1-[[2-(2-furyl)-6-nitro-imidazo[3,2-a]pyridin-3-yl]methyl]piperidine-4-carboxylic acid is a complex organic compound characterized by its unique structural features, which include a piperidine ring, a carboxylic acid functional group, and a fused imidazo-pyridine system. The presence of a nitro group and a furyl moiety contributes to its potential biological activity, making it of interest in medicinal chemistry. This compound is likely to exhibit moderate to high solubility in polar solvents due to the carboxylic acid group, while its aromatic components may enhance lipophilicity. The molecular structure suggests potential interactions with biological targets, possibly influencing enzyme activity or receptor binding. Its synthesis and characterization would typically involve standard organic chemistry techniques, including functional group transformations and purification methods such as chromatography. Given its complexity, it may also exhibit interesting pharmacokinetic properties, which would be essential for evaluating its therapeutic potential. Further studies would be necessary to elucidate its biological activity and mechanism of action.
Formula:C18H18N4O5
InChI:InChI=1/C18H18N4O5/c23-18(24)12-5-7-20(8-6-12)11-14-17(15-2-1-9-27-15)19-16-4-3-13(22(25)26)10-21(14)16/h1-4,9-10,12H,5-8,11H2,(H,23,24)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.