CAS 904818-18-4
:2-(1,3-benzodioxol-5-yl)-3H-benzimidazole-5-carboxylic acid
Description:
2-(1,3-benzodioxol-5-yl)-3H-benzimidazole-5-carboxylic acid is a chemical compound characterized by its complex structure, which includes a benzimidazole core fused with a benzodioxole moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in organic solvents depending on the specific functional groups present. The presence of the carboxylic acid group suggests it can participate in acid-base reactions, potentially forming salts or esters. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its reactivity and stability. The compound's unique features may also contribute to its potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Overall, 2-(1,3-benzodioxol-5-yl)-3H-benzimidazole-5-carboxylic acid represents a fascinating subject for further study in both synthetic and applied chemistry contexts.
Formula:C15H10N2O4
InChI:InChI=1/C15H10N2O4/c18-15(19)9-1-3-10-11(5-9)17-14(16-10)8-2-4-12-13(6-8)21-7-20-12/h1-6H,7H2,(H,16,17)(H,18,19)
Synonyms:- 2-(1,3-Benzodioxol-5-yl)-1H-benzimidazole-6-carboxylic acid
- 2-(1,3-Benzodioxol-5-yl)-1H-benzimidazole-5-carboxylic acid
- 2-(2H-1,3-benzodioxol-5-yl)-1H-1,3-benzodiazole-6-carboxylic acid
- 2-Benzo[1,3]dioxol-5-yl-1H-benzimidazole-5-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.