CAS 904818-21-9
:2-(2-furyl)-6-nitro-imidazo[1,2-a]pyridine
Description:
2-(2-Furyl)-6-nitro-imidazo[1,2-a]pyridine is a heterocyclic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. The presence of a nitro group at the 6-position enhances its reactivity and potential for biological activity, while the furyl substituent at the 2-position introduces additional electronic and steric effects. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both nitrogen-containing heterocycles and functional groups that can participate in various chemical reactions. The compound's properties, such as melting point, boiling point, and spectral characteristics, would be influenced by its molecular structure and the interactions between its functional groups. As with many heterocycles, it may also exhibit interesting biological activities, warranting further investigation in drug discovery and development contexts.
Formula:C11H7N3O3
InChI:InChI=1/C11H7N3O3/c15-14(16)8-3-4-11-12-9(7-13(11)6-8)10-2-1-5-17-10/h1-7H
Synonyms:- 2-(2-Furyl)-6-nitroimidazo[1,2-a]pyridin
- imidazo[1,2-a]pyridine, 2-(2-furanyl)-6-nitro-
- 2-(2-Furyl)-6-nitroimidazo[1,2-a]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.