CAS 904818-42-4
:1-(2-Nitrophenyl)-3-phenylpiperazine
Description:
1-(2-Nitrophenyl)-3-phenylpiperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The compound features a 2-nitrophenyl group and a phenyl group attached to the piperazine structure, contributing to its unique properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the nitro group introduces polar characteristics, which can influence its reactivity and interaction with biological systems. This compound may be of interest in medicinal chemistry due to its potential pharmacological activities, particularly in the context of neuropharmacology, where piperazine derivatives are often explored for their effects on neurotransmitter systems. Safety and handling precautions should be observed, as nitro compounds can be sensitive and may pose health risks. As with any chemical, proper characterization through techniques such as NMR, IR spectroscopy, and mass spectrometry is essential for confirming its structure and purity.
Formula:C16H17N3O2
InChI:InChI=1/C16H17N3O2/c20-19(21)16-9-5-4-8-15(16)18-11-10-17-14(12-18)13-6-2-1-3-7-13/h1-9,14,17H,10-12H2
SMILES:c1ccc(cc1)C1CN(CCN1)c1ccccc1N(=O)=O
Synonyms:- 1-(2-Nitrophenyl)-3-phenylpiperazin
- Piperazine, 1-(2-Nitrophenyl)-3-Phenyl-
- 1-(2-nitrophenyl)-3-phenylpiperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
