CAS 904818-64-0

2-(4-hydroxy-3-methoxy-phenyl)-1H-benzimidazole-5-carboxylic acid

Description:

2-(4-Hydroxy-3-methoxy-phenyl)-1H-benzimidazole-5-carboxylic acid, with the CAS number 904818-64-0, is a chemical compound characterized by its complex structure, which includes a benzimidazole core substituted with a carboxylic acid group and a phenolic moiety. This compound typically exhibits properties such as moderate solubility in polar solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the hydroxyl and methoxy groups suggests that it may engage in hydrogen bonding and exhibit antioxidant properties. Additionally, the benzimidazole framework is known for its role in various biological activities, including antimicrobial and anticancer effects. The compound's specific interactions and efficacy would depend on its molecular conformation and the presence of functional groups, which can influence its reactivity and biological activity. Overall, this substance represents a class of compounds that may have significant applications in medicinal chemistry and drug development.

Formula: C₁₅H₁₂N₂O₄

InChI: InChI=1/C15H12N2O4/c1-21-13-7-8(3-5-12(13)18)14-16-10-4-2-9(15(19)20)6-11(10)17-14/h2-7,18H,1H3,(H,16,17)(H,19,20)

SMILES: COc1cc(ccc1O)c1nc2ccc(cc2[nH]1)C(=O)O

2-(4-Hydroxy-3-methoxyphenyl)-1H-benzimidazole-5-carboxylic acid

CAS: 904818-64-0

2-(4-Hydroxy-3-methoxyphenyl)-1H-benzimidazole-5-carboxylic acid

Purity: ≥95%

Molecular weight: 284.27g/mol

Ref: 54-OR13881