CAS 90482-29-4

3-Oxocycloheptanecarboxylic acid

Description:

3-Oxocycloheptanecarboxylic acid is an organic compound characterized by its cyclic structure and functional groups. It features a cycloheptane ring, which is a seven-membered carbon ring, with a ketone group (3-oxo) and a carboxylic acid group (-COOH) attached to it. This compound exhibits typical properties of carboxylic acids, such as acidity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the ketone group contributes to its reactivity, allowing for potential participation in various organic reactions, including nucleophilic additions and condensation reactions. The molecular structure suggests that it may exhibit stereoisomerism due to the cyclic nature of the compound, which can lead to different spatial arrangements of substituents. Additionally, its unique structure may impart specific biological or pharmacological activities, making it of interest in medicinal chemistry and organic synthesis. Overall, 3-oxocycloheptanecarboxylic acid is a versatile compound with potential applications in various chemical fields.

Formula: C₈H₁₂O₃

InChI: InChI=1/C8H12O3/c9-7-4-2-1-3-6(5-7)8(10)11/h6H,1-5H2,(H,10,11)

SMILES: C1CCC(=O)CC(C1)C(=O)O

Synonyms:

• Cycloheptanecarboxylic Acid, 3-Oxo-

Cycloheptanecarboxyl​ic acid, 4-​oxo-

CAS: 90482-29-4

Formula: C₈H₁₂O₃

Purity: 97%

Molecular weight: 156.1791

Ref: IN-DA006P7A

4-OXOCYCLOHEPTANECARBOXYLIC ACID

CAS: 90482-29-4

Formula: C₈H₁₂O₃

Purity: 97.0%

Color and Shape: Liquid

Molecular weight: 156.181

Ref: 10-F303369

4-Oxocycloheptane-1-carboxylic acid

CAS: 90482-29-4

Versatile small molecule scaffold

Formula: C₈H₁₂O₃

Purity: Min. 95%

Molecular weight: 156.18 g/mol

Ref: 3D-QDA48229