CAS 90483-95-7
:1-oxo-1,3-dihydro-2-benzofuran-4-carbonitrile
Description:
1-Oxo-1,3-dihydro-2-benzofuran-4-carbonitrile, with the CAS number 90483-95-7, is a chemical compound characterized by its unique structure that combines a benzofuran moiety with a carbonitrile functional group. This compound typically exhibits a fused ring system, which contributes to its stability and potential reactivity. The presence of the carbonitrile group indicates that it may participate in nucleophilic reactions, making it a candidate for various synthetic applications. Additionally, the oxo group suggests potential for hydrogen bonding and further reactivity, particularly in organic synthesis. The compound may also display interesting physical properties, such as solubility in organic solvents, and could be of interest in medicinal chemistry due to its structural features that may influence biological activity. Overall, 1-oxo-1,3-dihydro-2-benzofuran-4-carbonitrile represents a versatile scaffold for further chemical exploration and potential applications in pharmaceuticals or agrochemicals.
Formula:C9H5NO2
InChI:InChI=1/C9H5NO2/c10-4-6-2-1-3-7-8(6)5-12-9(7)11/h1-3H,5H2
Synonyms:- 1-Oxo-1,3-dihydro-isobenzofuran-4-c
- 1-Oxo-1,3-dihydro-2-benzofuran-4-carbonitrile
- 4-isobenzofurancarbonitrile, 1,3-dihydro-1-oxo-
- arbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
