CAS 90484-42-7

5-(4-bromophenyl)sulfanylthiazol-2-amine

Description:

5-(4-Bromophenyl)sulfanylthiazol-2-amine is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The presence of a bromophenyl group indicates that a bromine atom is substituted on a phenyl ring, contributing to the compound's potential reactivity and biological activity. The sulfanyl group (–S–) attached to the thiazole enhances its properties, possibly influencing its solubility and interaction with biological targets. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in the fields of antimicrobial or anticancer research. The CAS number 90484-42-7 uniquely identifies this substance, facilitating its recognition in scientific literature and databases. Overall, the combination of the thiazole, sulfanyl, and bromophenyl functionalities suggests a compound with diverse chemical properties and potential utility in various chemical and biological applications.

Formula: C₉H₇BrN₂S₂

InChI: InChI=1/C9H7BrN2S2/c10-6-1-3-7(4-2-6)13-8-5-12-9(11)14-8/h1-5H,(H2,11,12)

SMILES: c1cc(ccc1Br)Sc1c[nH]c(=N)s1

2-Amino-5-[(4-bromophenyl)thio]-1,3-thiazole

CAS: 90484-42-7

2-Amino-5-[(4-bromophenyl)thio]-1,3-thiazole

Purity: ≥95%

Molecular weight: 287.20g/mol

Ref: 54-OR12173