CAS 904929-06-2

Ethyl 3-amino-6,7-dihydro-5H-cyclopenta[b]pyridine-7-acetate

Description:

Ethyl 3-amino-6,7-dihydro-5H-cyclopenta[b]pyridine-7-acetate is a chemical compound characterized by its unique bicyclic structure, which incorporates both a pyridine and a cyclopentane moiety. This compound features an amino group and an ethyl acetate functional group, contributing to its potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding and could act as a nucleophile in various chemical reactions. The cyclopentane ring adds to the compound's rigidity and may influence its interaction with biological targets. Ethyl 3-amino-6,7-dihydro-5H-cyclopenta[b]pyridine-7-acetate is of interest in medicinal chemistry, particularly for its potential pharmacological properties. Its CAS number, 904929-06-2, allows for easy identification in chemical databases. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions, making it essential to consider these factors in practical applications. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.

Formula: C₁₂H₁₆N₂O₂

InChI: InChI=1S/C12H16N2O2/c1-2-16-11(15)6-9-4-3-8-5-10(13)7-14-12(8)9/h5,7,9H,2-4,6,13H2,1H3

InChI key: InChIKey=IEMGWBMVQLVHEY-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)C1C=2C(CC1)=CC(N)=CN2

Synonyms:

• Ethyl 3-amino-6,7-dihydro-5H-cyclopenta[b]pyridine-7-acetate
• 5H-Cyclopenta[b]pyridine-7-acetic acid, 3-amino-6,7-dihydro-, ethyl ester