CymitQuimica logo

CAS 904999-07-1

:

2-Chloro-N-(3-cyano-4,5,6,7-tetrahydro-6-phenylbenzo[b]thien-2-yl)acetamide

Description:
2-Chloro-N-(3-cyano-4,5,6,7-tetrahydro-6-phenylbenzo[b]thien-2-yl)acetamide is a synthetic organic compound characterized by its complex molecular structure, which includes a chloro group, a cyano group, and a benzo[b]thien moiety. This compound features a tetrahydro structure that contributes to its potential biological activity. The presence of the chloro substituent may influence its reactivity and solubility, while the cyano group can enhance its electronic properties, making it a candidate for various chemical reactions. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its molecular interactions may be influenced by the steric and electronic effects of the phenyl and thienyl groups, which can affect binding affinity and selectivity in biological systems. As with many synthetic compounds, understanding its stability, solubility, and reactivity is crucial for its application in research and industry.
Formula:C17H15ClN2OS
InChI:InChI=1S/C17H15ClN2OS/c18-9-16(21)20-17-14(10-19)13-7-6-12(8-15(13)22-17)11-4-2-1-3-5-11/h1-5,12H,6-9H2,(H,20,21)
InChI key:InChIKey=VHXORCUCQFTNBZ-UHFFFAOYSA-N
SMILES:C(#N)C=1C2=C(SC1NC(CCl)=O)CC(CC2)C3=CC=CC=C3
Synonyms:
  • 2-Chloro-N-(3-cyano-4,5,6,7-tetrahydro-6-phenylbenzo[b]thien-2-yl)acetamide
  • Acetamide, 2-chloro-N-(3-cyano-4,5,6,7-tetrahydro-6-phenylbenzo[b]thien-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.