CAS 905-14-6
:ethyl bis(4-nitrophenyl) phosphate
Description:
Ethyl bis(4-nitrophenyl) phosphate, with the CAS number 905-14-6, is an organophosphate compound characterized by its phosphate ester structure. It features two 4-nitrophenyl groups attached to a phosphate moiety, which contributes to its chemical properties and biological activity. This compound is typically a pale yellow solid or liquid, depending on its purity and specific formulation. Ethyl bis(4-nitrophenyl) phosphate is known for its use as an insecticide and acaricide, functioning by inhibiting acetylcholinesterase, an essential enzyme in the nervous system of insects. Its nitrophenyl groups enhance its reactivity and potential for biological activity. The compound is soluble in organic solvents but has limited solubility in water, which affects its environmental behavior and bioavailability. Safety considerations are important, as organophosphates can be toxic to humans and wildlife, necessitating careful handling and application. Overall, ethyl bis(4-nitrophenyl) phosphate exemplifies the diverse applications and significant risks associated with organophosphate chemicals in agriculture and pest management.
Formula:C14H13N2O8P
InChI:InChI=1/C14H13N2O8P/c1-2-22-25(21,23-13-7-3-11(4-8-13)15(17)18)24-14-9-5-12(6-10-14)16(19)20/h3-10H,2H2,1H3
SMILES:CCOP(=O)(Oc1ccc(cc1)N(=O)=O)Oc1ccc(cc1)N(=O)=O
Synonyms:- O-Ethyl O,O-Bis(4-Nitrophenyl) Phosphorate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
