CAS 905011-53-2

1-Methylethyl 2-amino-5-methyl-4-[4-(1-methylpropyl)phenyl]-3-thiophenecarboxylate

Description:

1-Methylethyl 2-amino-5-methyl-4-[4-(1-methylpropyl)phenyl]-3-thiophenecarboxylate, identified by its CAS number 905011-53-2, is a synthetic organic compound characterized by its complex molecular structure, which includes a thiophene ring, an amino group, and multiple alkyl substituents. This compound likely exhibits properties typical of thiophene derivatives, such as potential aromaticity and reactivity due to the presence of the amino group. The presence of multiple methyl and propyl groups suggests that it may have hydrophobic characteristics, influencing its solubility and interaction with biological systems. Additionally, the compound may exhibit biological activity, potentially serving as a pharmacophore in medicinal chemistry. Its structural complexity indicates that it could participate in various chemical reactions, including nucleophilic substitutions or electrophilic additions, depending on the functional groups present. Overall, this compound's unique structure may contribute to its potential applications in pharmaceuticals or materials science, although specific biological or chemical properties would require further empirical investigation.

Formula: C₁₉H₂₅NO₂S

InChI: InChI=1S/C19H25NO2S/c1-6-12(4)14-7-9-15(10-8-14)16-13(5)23-18(20)17(16)19(21)22-11(2)3/h7-12H,6,20H2,1-5H3

InChI key: InChIKey=VDLBELHYTBBCCX-UHFFFAOYSA-N

SMILES: C(OC(C)C)(=O)C=1C(=C(C)SC1N)C2=CC=C(C(CC)C)C=C2

Synonyms:

• 1-Methylethyl 2-amino-5-methyl-4-[4-(1-methylpropyl)phenyl]-3-thiophenecarboxylate
• 3-Thiophenecarboxylic acid, 2-amino-5-methyl-4-[4-(1-methylpropyl)phenyl]-, 1-methylethyl ester