CAS 90505-66-1
:4-{3-[bis(2-hydroxy-2-phenylethyl)amino]butyl}benzamide
Description:
4-{3-[Bis(2-hydroxy-2-phenylethyl)amino]butyl}benzamide, with the CAS number 90505-66-1, is a synthetic organic compound characterized by its complex structure, which includes an aromatic benzamide moiety and a flexible aliphatic chain. This compound features two bis(2-hydroxy-2-phenylethyl) amino groups, contributing to its potential as a ligand or pharmaceutical agent. The presence of hydroxyl groups enhances its solubility in polar solvents and may facilitate hydrogen bonding, influencing its biological activity and interaction with other molecules. The compound's structure suggests potential applications in medicinal chemistry, particularly in drug design, due to its ability to interact with biological targets. Additionally, the presence of multiple functional groups may impart unique properties such as increased stability or reactivity under specific conditions. Overall, 4-{3-[bis(2-hydroxy-2-phenylethyl)amino]butyl}benzamide represents a versatile chemical entity with potential implications in various fields, including pharmacology and materials science.
Formula:C27H32N2O3
InChI:InChI=1/C27H32N2O3/c1-20(12-13-21-14-16-24(17-15-21)27(28)32)29(18-25(30)22-8-4-2-5-9-22)19-26(31)23-10-6-3-7-11-23/h2-11,14-17,20,25-26,30-31H,12-13,18-19H2,1H3,(H2,28,32)
Synonyms:- Ro16-8714
- Ro 16-8714
- Ro-16-8714
- 4-(3-(bis(beta-hydroxyphenethyl)amino)butyl)benzamide
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ro 16-8714
CAS:<p>Ro 16-8714 is an agonist of beta-adrenoreceptor with antihyperglycemic and thermogenic properties.</p>Formula:C27H32N2O3Color and Shape:SolidMolecular weight:432.55
