CymitQuimica logo

CAS 90508-22-8

:

L-Serine, N-[(2-propenyloxy)carbonyl]-

Description:
L-Serine, N-[(2-propenyloxy)carbonyl]- is a chemical compound characterized by its structure, which includes an L-serine backbone modified with a propenyloxycarbonyl group. This modification imparts unique properties to the molecule, making it of interest in various biochemical applications. L-serine itself is a non-essential amino acid that plays a crucial role in protein synthesis and is involved in several metabolic pathways, including the synthesis of neurotransmitters. The presence of the propenyloxycarbonyl group suggests potential reactivity, particularly in organic synthesis or polymer chemistry, where it may serve as a functional group for further chemical transformations. The compound is likely to exhibit solubility in polar solvents due to the amino and hydroxyl groups present in the serine structure. Additionally, its molecular interactions may be influenced by the presence of the carbonyl and ether functionalities, which can participate in hydrogen bonding and other intermolecular interactions. Overall, this compound may have applications in pharmaceuticals, biochemistry, and materials science, although specific uses would depend on further research and development.
Formula:C7H11NO5
InChI:InChI=1S/C7H11NO5/c1-2-3-13-7(12)8-5(4-9)6(10)11/h2,5,9H,1,3-4H2,(H,8,12)(H,10,11)/t5-/m0/s1
InChI key:GYRYAHKJRNWKMK-YFKPBYRVSA-N
SMILES:C=CCOC(=O)N[C@@H](CO)C(=O)O
Found 1 products.