CAS 9052-45-3
:Acrylic acid-divinylbenzene copolymer
Description:
Acrylic acid-divinylbenzene copolymer, identified by the CAS number 9052-45-3, is a synthetic polymer that exhibits a range of notable characteristics. This copolymer is formed through the polymerization of acrylic acid and divinylbenzene, resulting in a cross-linked structure that enhances its stability and mechanical properties. It is typically a white to off-white solid and is insoluble in water, making it suitable for various applications in different environments. The copolymer is known for its high surface area and porosity, which contribute to its effectiveness as an adsorbent material in chromatography and water treatment processes. Additionally, it demonstrates good thermal stability and chemical resistance, allowing it to withstand harsh conditions. Its functional groups provide sites for further chemical modification, enabling customization for specific applications. Overall, acrylic acid-divinylbenzene copolymer is valued in fields such as pharmaceuticals, environmental science, and materials engineering due to its versatility and performance characteristics.
Formula:(C10H10·C3H4O2)x
InChI:InChI=1/C10H10.C3H4O2/c1-3-9-7-5-6-8-10(9)4-2;1-2-3(4)5/h3-8H,1-2H2;2H,1H2,(H,4,5)
SMILES:C=Cc1ccccc1C=C.C=CC(=O)O
Synonyms:- Acrylic acid-divinylbenzene polymer
- Divinylbenzene-acrylic acid polymer
- Benzene, diethenyl-, polymer with 2-propenoic acid
- 2-Propenoic acid, polymer with diethenylbenzene
- Divinylbenzene-acrylic acid copolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

