
CAS 905273-35-0
:3-Bromo-6,7-dihydro-6-(triphenylmethyl)-5H-pyrrolo[3,4-b]pyridine
Description:
3-Bromo-6,7-dihydro-6-(triphenylmethyl)-5H-pyrrolo[3,4-b]pyridine is a complex organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine moieties. The presence of a bromine atom at the 3-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The triphenylmethyl group enhances the compound's stability and solubility, making it suitable for various chemical reactions. This compound may exhibit interesting biological activities due to its structural features, which can influence interactions with biological targets. Its molecular structure allows for potential applications in drug development, particularly in the design of novel pharmaceuticals. Additionally, the compound's properties, such as melting point, solubility, and spectral characteristics, can be influenced by the presence of the bromine and triphenylmethyl groups, making it a subject of interest for further research in both synthetic and medicinal chemistry.
Formula:C26H21BrN2
InChI:InChI=1S/C26H21BrN2/c27-24-16-20-18-29(19-25(20)28-17-24)26(21-10-4-1-5-11-21,22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-17H,18-19H2
InChI key:InChIKey=AMBWLXFCRSBNJS-UHFFFAOYSA-N
SMILES:C(N1CC=2C(C1)=CC(Br)=CN2)(C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5
Synonyms:- 5H-Pyrrolo[3,4-b]pyridine, 3-bromo-6,7-dihydro-6-(triphenylmethyl)-
- 3-Bromo-6-trityl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine
- 3-Bromo-6,7-dihydro-6-(triphenylmethyl)-5H-pyrrolo[3,4-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.