CAS 905273-60-1

4-Fluoro-5-(trifluoromethyl)-1,2-benzenedicarboxylic acid

Description:

4-Fluoro-5-(trifluoromethyl)-1,2-benzenedicarboxylic acid is an aromatic compound characterized by the presence of a fluorine atom and a trifluoromethyl group attached to a benzene ring that also contains two carboxylic acid functional groups. This compound is typically a solid at room temperature and exhibits high stability due to the strength of the carbon-fluorine bonds. The presence of multiple electronegative fluorine atoms contributes to its unique chemical properties, including increased acidity and potential reactivity in various chemical reactions. The carboxylic acid groups can participate in hydrogen bonding, influencing its solubility in polar solvents. Additionally, the trifluoromethyl group enhances lipophilicity, making the compound of interest in medicinal chemistry and materials science. Its specific applications may include use as an intermediate in the synthesis of pharmaceuticals or agrochemicals, as well as in the development of functional materials. Safety and handling precautions are essential due to the potential toxicity associated with fluorinated compounds.

Formula: C₉H₄F₄O₄

InChI: InChI=1S/C9H4F4O4/c10-6-2-4(8(16)17)3(7(14)15)1-5(6)9(11,12)13/h1-2H,(H,14,15)(H,16,17)

InChI key: InChIKey=VUOJHSANHIUFQO-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C(O)=O)C=C(F)C(C(F)(F)F)=C1

Synonyms:

• 4-Fluoro-5-(trifluoromethyl)-1,2-benzenedicarboxylic acid
• 1,2-Benzenedicarboxylic acid, 4-fluoro-5-(trifluoromethyl)-
• 4-Fluoro-5-trifluoromethyl-phthalic acid

4-Fluoro-5-trifluoromethyl-phthalic Acid

Controlled Product

CAS: 905273-60-1

Formula: C₉H₄F₄O₄

Color and Shape: Neat

Molecular weight: 252.119

Ref: TR-F457800