CAS 90534-46-6
:2-ethyl-6-methoxyphenol
Description:
2-Ethyl-6-methoxyphenol, with the CAS number 90534-46-6, is an organic compound characterized by its aromatic structure, which includes a phenolic group. This compound features an ethyl group and a methoxy group attached to the benzene ring, influencing its chemical properties and reactivity. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the methoxy group enhances its solubility in organic solvents while imparting certain hydrophobic characteristics. 2-Ethyl-6-methoxyphenol exhibits antioxidant properties, making it of interest in various applications, including cosmetics and food preservation. Additionally, it may have potential uses in pharmaceuticals due to its structural similarity to other biologically active compounds. The compound's stability and reactivity can be influenced by factors such as temperature and pH, and it is important to handle it with care, following appropriate safety guidelines, as with many organic chemicals.
Formula:C9H12O2
InChI:InChI=1/C9H12O2/c1-3-7-5-4-6-8(11-2)9(7)10/h4-6,10H,3H2,1-2H3
SMILES:CCc1cccc(c1O)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Ethyl-6-methoxyphenol
CAS:Controlled ProductFormula:C9H12O2Color and Shape:NeatMolecular weight:152.19

