CAS 90535-72-1

4-amino-5-(benzylsulfanyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

4-amino-5-(benzylsulfanyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features an amino group and a benzylsulfanyl substituent, contributing to its potential reactivity and biological activity. The presence of the thione functional group indicates that it contains a sulfur atom double-bonded to a carbon atom, which can influence its chemical properties, such as its acidity and ability to participate in nucleophilic reactions. The compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the triazole ring, making it a subject of study in both organic synthesis and drug development.

Formula: C₉H₁₀N₄S₂

InChI: InChI=1/C9H10N4S2/c10-13-8(14)11-12-9(13)15-6-7-4-2-1-3-5-7/h1-5H,6,10H2,(H,11,14)

SMILES: c1ccc(cc1)CSc1nnc(n1N)S

Synonyms:

• 4-amino-5-(benzylthio)-4H-1,2,4-triazole-3-thiol

4-Amino-5-(benzylsulfanyl)-4h-1,2,4-triazole-3-thiol

CAS: 90535-72-1

4-Amino-5-(benzylsulfanyl)-4h-1,2,4-triazole-3-thiol

Purity: 95%

Molecular weight: 238.33g/mol

Ref: 54-OR86153

4-amino-3-(benzylsulfanyl)-4,5-dihydro-1H-1,2,4-triazole-5-thione

CAS: 90535-72-1

Purity: 97%

Molecular weight: 238.3300018

Ref: 10-F645065