CAS 90537-57-8

6-Chloro-2-hydrazinylquinoline

Description:

6-Chloro-2-hydrazinylquinoline is a chemical compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. The presence of a chloro group at the 6-position and a hydrazinyl group at the 2-position contributes to its unique reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. It is of interest in medicinal chemistry due to its potential applications in drug development, particularly in the context of antitumor and antimicrobial activities. The hydrazinyl functional group can participate in various chemical reactions, including hydrazone formation and redox reactions, making it a versatile building block in organic synthesis. Safety data indicates that, like many nitrogen-containing heterocycles, it should be handled with care due to potential toxicity and reactivity. As with any chemical substance, proper safety protocols should be followed when handling or experimenting with 6-Chloro-2-hydrazinylquinoline.

Formula: C₉H₈ClN₃

InChI: InChI=1S/C9H8ClN3/c10-7-2-3-8-6(5-7)1-4-9(12-8)13-11/h1-5H,11H2,(H,12,13)

InChI key: InChIKey=JJQFWCVYYJQQPG-UHFFFAOYSA-N

SMILES: N(N)=C1NC=2C(=CC(Cl)=CC2)C=C1

Synonyms:

• Quinoline, 6-chloro-2-hydrazino-
• 6-Chloro-2-hydrazinylquinoline
• Quinoline, 6-chloro-2-hydrazinyl-