CAS 905439-49-8
:5-Iodo-2-methyl-3-nitropyridine
Description:
5-Iodo-2-methyl-3-nitropyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of an iodine atom at the 5-position, a methyl group at the 2-position, and a nitro group at the 3-position contributes to its unique chemical properties. This compound is typically a yellow to brown solid and is soluble in organic solvents. It exhibits reactivity due to the presence of the nitro group, which can participate in electrophilic substitution reactions, and the iodine atom, which can facilitate nucleophilic substitution. The methyl group influences the electronic distribution within the ring, potentially affecting its reactivity and interactions with other chemical species. 5-Iodo-2-methyl-3-nitropyridine may be utilized in various applications, including pharmaceuticals and agrochemicals, due to its potential biological activity and ability to serve as a building block in organic synthesis. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C6H5IN2O2
InChI:InChI=1S/C6H5IN2O2/c1-4-6(9(10)11)2-5(7)3-8-4/h2-3H,1H3
InChI key:InChIKey=QLXUGOYUTFGIFY-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C)N=CC(I)=C1
Synonyms:- Pyridine, 5-iodo-2-methyl-3-nitro-
- 5-Iodo-2-methyl-3-nitropyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
