CAS 90544-88-0

N-(4-Nitrophenyl)glycine methyl ester

Description:

N-(4-Nitrophenyl)glycine methyl ester is an organic compound characterized by its structure, which includes a glycine moiety substituted with a 4-nitrophenyl group and a methyl ester functional group. This compound typically appears as a solid or crystalline substance and is known for its potential applications in pharmaceuticals and organic synthesis. The presence of the nitrophenyl group contributes to its electronic properties, making it a useful intermediate in the synthesis of various bioactive molecules. It is generally soluble in organic solvents, such as methanol and ethanol, but may have limited solubility in water. The compound can undergo various chemical reactions, including hydrolysis, reduction, and coupling reactions, which are valuable in synthetic organic chemistry. Safety data sheets should be consulted for handling and storage guidelines, as with many nitro compounds, it may pose certain hazards. Overall, N-(4-Nitrophenyl)glycine methyl ester is a versatile compound with significant relevance in chemical research and development.

Formula: C₉H₁₀N₂O₄

InChI: InChI=1S/C9H10N2O4/c1-15-9(12)6-10-7-2-4-8(5-3-7)11(13)14/h2-5,10H,6H2,1H3

InChI key: InChIKey=HMJSBNVWZWUVAO-UHFFFAOYSA-N

SMILES: N(CC(OC)=O)C1=CC=C(N(=O)=O)C=C1

Synonyms:

• N-(4-Nitrophenyl)glycine methyl ester
• Glycine, N-(4-nitrophenyl)-, methyl ester