CAS 905454-89-9

Phenol, 4-bromo-3-fluoro-, 1-acetate

Description:

Phenol, 4-bromo-3-fluoro-, 1-acetate, with the CAS number 905454-89-9, is an organic compound characterized by the presence of a phenolic structure substituted with bromine and fluorine atoms, as well as an acetate functional group. This compound typically exhibits properties associated with halogenated phenols, such as increased reactivity due to the electronegative halogen substituents. The bromine and fluorine atoms can influence the compound's polarity, solubility, and potential biological activity. The acetate group suggests that the compound may be involved in esterification reactions, making it relevant in synthetic organic chemistry. Additionally, the presence of both bromine and fluorine can enhance the compound's stability and alter its interaction with biological systems, potentially leading to applications in pharmaceuticals or agrochemicals. Overall, the unique combination of functional groups in this compound contributes to its chemical behavior and potential utility in various chemical applications.

Formula: C₈H₆BrFO₂

InChI: InChI=1S/C8H6BrFO2/c1-5(11)12-6-2-3-7(9)8(10)4-6/h2-4H,1H3

InChI key: InChIKey=UJQKVVSLWNHFIY-UHFFFAOYSA-N

SMILES: O(C(C)=O)C1=CC(F)=C(Br)C=C1

Synonyms:

• Phenol, 4-bromo-3-fluoro-, 1-acetate
• Phenol, 4-bromo-3-fluoro-, acetate