CAS 90556-28-8
:4-methyl-6-(propan-2-yloxy)pyrimidin-2-amine
Description:
4-Methyl-6-(propan-2-yloxy)pyrimidin-2-amine, with the CAS number 90556-28-8, is a chemical compound that belongs to the class of pyrimidine derivatives. This substance features a pyrimidine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The presence of a methyl group at position 4 and a propan-2-yloxy group at position 6 contributes to its unique chemical properties and potential biological activity. The amine functional group at position 2 indicates that it can participate in hydrogen bonding, which may influence its solubility and reactivity. Such compounds are often studied for their pharmacological properties, including potential applications in medicinal chemistry. The molecular structure suggests that it may exhibit specific interactions with biological targets, making it of interest in drug development. Additionally, the compound's stability, solubility, and reactivity can be influenced by the substituents on the pyrimidine ring, which can affect its overall behavior in various chemical environments.
Formula:C8H13N3O
InChI:InChI=1/C8H13N3O/c1-5(2)12-7-4-6(3)10-8(9)11-7/h4-5H,1-3H3,(H2,9,10,11)
SMILES:CC(C)Oc1cc(C)[nH]c(=N)n1
Synonyms:- 4-Isopropoxy-6-Methylpyrimidin-2-Amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
