CAS 90556-87-9
:ethyl 3-hydrazinylbenzoate
Description:
Ethyl 3-hydrazinylbenzoate is an organic compound characterized by the presence of both an ethyl ester and a hydrazine functional group attached to a benzoate structure. This compound features a hydrazinyl group (-NH-NH2) linked to the aromatic ring, specifically at the meta position relative to the ester group. Ethyl 3-hydrazinylbenzoate is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents such as ethanol and acetone but may have limited solubility in water due to its hydrophobic aromatic structure. The compound is of interest in various fields, including medicinal chemistry, where it may serve as a precursor for the synthesis of more complex molecules or as a potential pharmacophore due to the presence of the hydrazine moiety, which is known for its reactivity and biological activity. Safety precautions should be observed when handling this compound, as hydrazines can be toxic and potentially carcinogenic.
Formula:C9H12N2O2
InChI:InChI=1/C9H12N2O2/c1-2-13-9(12)7-4-3-5-8(6-7)11-10/h3-6,11H,2,10H2,1H3
SMILES:CCOC(=O)c1cccc(c1)NN
Synonyms:- Benzoic Acid, 3-Hydrazinyl-, Ethyl Ester
- Ethyl 3-hydrazinobenzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
