CAS 90558-40-0

{[4-(methylsulfonyl)-2-nitrophenyl]amino}acetate

Description:

The chemical substance known as {[4-(methylsulfonyl)-2-nitrophenyl]amino}acetate, with the CAS number 90558-40-0, is characterized by its complex molecular structure, which includes a nitrophenyl group, a methylsulfonyl moiety, and an aminoacetate functional group. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of both polar and nonpolar functional groups. It may display biological activity, potentially serving as a pharmaceutical intermediate or a research chemical, given its structural features that suggest interactions with biological systems. The presence of the nitro group can impart specific reactivity, while the methylsulfonyl group may enhance solubility and stability. Additionally, the compound's molecular weight and specific functional groups contribute to its overall chemical behavior, including reactivity and potential applications in various fields such as medicinal chemistry or agrochemicals. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or environmental impact.

Formula: C₉H₉N₂O₆S

InChI: InChI=1/C9H10N2O6S/c1-18(16,17)6-2-3-7(10-5-9(12)13)8(4-6)11(14)15/h2-4,10H,5H2,1H3,(H,12,13)/p-1

SMILES: CS(=O)(=O)c1ccc(c(c1)N(=O)=O)NCC(=O)[O-]

2-[(4-Methanesulfonyl-2-nitrophenyl)amino]acetic acid

CAS: 90558-40-0

Versatile small molecule scaffold

Formula: C₉H₁₀N₂O₆S

Purity: Min. 95%

Molecular weight: 274.25 g/mol

Ref: 3D-QDA55840