CAS 905587-18-0
:N-[1-(5-Fluoro-2-pyridinyl)ethenyl]acetamide
Description:
N-[1-(5-Fluoro-2-pyridinyl)ethenyl]acetamide, with the CAS number 905587-18-0, is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a fluorine atom and an ethenyl group linked to an acetamide moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and interaction with biological targets. The presence of the fluorine atom can enhance lipophilicity and metabolic stability, making it of interest in medicinal chemistry. Additionally, the acetamide functional group may impart hydrogen bonding capabilities, influencing solubility and binding interactions in biological systems. As a result, compounds like this are often explored for their pharmacological properties, particularly in the development of new therapeutic agents. Its synthesis and characterization would involve standard organic chemistry techniques, and its behavior in various chemical environments can be studied through spectroscopic methods and biological assays.
Formula:C9H9FN2O
InChI:InChI=1S/C9H9FN2O/c1-6(12-7(2)13)9-4-3-8(10)5-11-9/h3-5H,1H2,2H3,(H,12,13)
InChI key:InChIKey=GSBSUXANMWUJAL-UHFFFAOYSA-N
SMILES:C(NC(C)=O)(=C)C1=CC=C(F)C=N1
Synonyms:- Acetamide, N-[1-(5-fluoro-2-pyridinyl)ethenyl]-
- N-[1-(5-Fluoro-2-pyridinyl)ethenyl]acetamide
- N-(1-(5-Fluoropyridin-2-yl)vinyl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
