CAS 90559-19-6

1,2,3,4-tetrahydroquinoxaline-2-carboxamide

Description:

1,2,3,4-Tetrahydroquinoxaline-2-carboxamide is a bicyclic organic compound characterized by its unique structure, which includes a quinoxaline ring system and a carboxamide functional group. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, reflecting its polar nature due to the carboxamide group. It is known for its potential biological activities, including neuroprotective and anticonvulsant properties, making it of interest in medicinal chemistry. The presence of the tetrahydro moiety contributes to its stability and reactivity, allowing for various chemical modifications. Additionally, its molecular structure allows for interactions with biological targets, which can be explored in drug development. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices. Overall, 1,2,3,4-tetrahydroquinoxaline-2-carboxamide represents a significant compound in the realm of organic and medicinal chemistry.

Formula: C₉H₁₁N₃O

InChI: InChI=1/C9H11N3O/c10-9(13)8-5-11-6-3-1-2-4-7(6)12-8/h1-4,8,11-12H,5H2,(H2,10,13)

SMILES: c1ccc2c(c1)NCC(C(=N)O)N2

1,2,3,4-Tetrahydroquinoxaline-2-carboxamide

CAS: 90559-19-6

Versatile small molecule scaffold

Formula: C₉H₁₁N₃O

Purity: Min. 95%

Molecular weight: 177.2 g/mol

Ref: 3D-QDA55919