CymitQuimica logo

CAS 905592-33-8

:

4-(3-ethoxyphenyl)-4-oxo-butanoic acid

Description:
4-(3-Ethoxyphenyl)-4-oxo-butanoic acid, identified by its CAS number 905592-33-8, is an organic compound characterized by its functional groups and structural features. It contains a butanoic acid backbone with a ketone group at the fourth carbon and an ethoxy-substituted phenyl group at the first carbon. This compound is likely to exhibit properties typical of both carboxylic acids and ketones, including potential acidity due to the carboxylic acid group and reactivity associated with the carbonyl group. The presence of the ethoxy group may influence its solubility in organic solvents and its overall polarity. Additionally, the aromatic ring can contribute to the compound's stability and may participate in various chemical reactions, such as electrophilic substitution. The compound's molecular structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis, although specific applications would depend on further research into its biological activity and reactivity. Overall, this compound represents a unique combination of functional groups that could lead to diverse chemical behavior.
Formula:C12H14O4
InChI:InChI=1/C12H14O4/c1-2-16-10-5-3-4-9(8-10)11(13)6-7-12(14)15/h3-5,8H,2,6-7H2,1H3,(H,14,15)
SMILES:CCOc1cccc(c1)C(=O)CCC(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.