CAS 90560-54-6
:N-(2-Bromo-4-methylphenyl)-2-chloroacetamide
Description:
N-(2-Bromo-4-methylphenyl)-2-chloroacetamide, with the CAS number 90560-54-6, is an organic compound characterized by its amide functional group, which is linked to a chloroacetamide moiety. The presence of a bromine atom and a methyl group on the aromatic ring contributes to its unique chemical properties and reactivity. This compound typically exhibits moderate solubility in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the aromatic structure. The bromine and chlorine substituents can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may possess biological activity, which could be of interest in pharmaceutical research. Its structural features suggest potential applications in medicinal chemistry, agrochemicals, or as an intermediate in organic synthesis. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.
Formula:C9H9BrClNO
InChI:InChI=1S/C9H9BrClNO/c1-6-2-3-8(7(10)4-6)12-9(13)5-11/h2-4H,5H2,1H3,(H,12,13)
InChI key:InChIKey=FNUAOVLAPWPQET-UHFFFAOYSA-N
SMILES:N(C(CCl)=O)C1=C(Br)C=C(C)C=C1
Synonyms:- N-(2-Bromo-4-methyl-phenyl)-2-chloro-acetamide
- acetamide, N-(2-bromo-4-methylphenyl)-2-chloro-
- p-Acetotoluidide, 2′-bromo-2-chloro-
- N-(2-Bromo-4-methylphenyl)-2-chloroacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
