CAS 90561-76-5

N-[(4-Bromophenyl)methyl]acetamide

Description:

N-[(4-Bromophenyl)methyl]acetamide, with the CAS number 90561-76-5, is an organic compound characterized by its amide functional group. It features a brominated phenyl ring, which enhances its reactivity and potential biological activity. The presence of the acetamide moiety suggests that it may exhibit properties typical of amides, such as moderate solubility in polar solvents and stability under various conditions. The bromine atom on the phenyl ring can influence the compound's electronic properties, potentially affecting its interactions in biological systems or chemical reactions. This compound may be of interest in medicinal chemistry due to the presence of the bromophenyl group, which is often associated with pharmacological activity. Additionally, its structure allows for potential modifications that could lead to derivatives with varied properties. Overall, N-[(4-Bromophenyl)methyl]acetamide is a compound that combines features of both aromatic and amide chemistry, making it a subject of interest in various research fields, including organic synthesis and drug development.

Formula: C₉H₁₀BrNO

InChI: InChI=1S/C9H10BrNO/c1-7(12)11-6-8-2-4-9(10)5-3-8/h2-5H,6H2,1H3,(H,11,12)

InChI key: InChIKey=HBBBWKUVJSIFKV-UHFFFAOYSA-N

SMILES: C(NC(C)=O)C1=CC=C(Br)C=C1

Synonyms:

• N-(4-Bromobenzyl)acetamide
• N-[(4-Bromophenyl)methyl]acetamide
• Acetamide, N-[(4-bromophenyl)methyl]-
• Acetamide, N-(p-bromobenzyl)-

AcetaMide, N-[(4-broMophenyl)Methyl]-

CAS: 90561-76-5

Formula: C₉H₁₀BrNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 228.0858

Ref: IN-DA00H4KL

N-[(4-Bromophenyl)methyl]acetamide

CAS: 90561-76-5

N-[(4-Bromophenyl)methyl]acetamide

Purity: 97%

Molecular weight: 228.09g/mol

Ref: 54-OR32516

N-(4-Bromobenzyl)acetamide

CAS: 90561-76-5

Purity: 98%

Molecular weight: 228.0890045

Ref: 10-F633897

N-[(4-Bromophenyl)methyl]acetamide

CAS: 90561-76-5

N-[(4-Bromophenyl)methyl]acetamide is a chemical synthesis of lipase. The synthesis was done in a vessel, and the synthetic pathways were highlighted. The molecule was synthesized using chemistry and biomimetic methods. It was amidated to form its final product. The reaction vessel is palladium-based, which makes it an efficient catalyst for the amidation reaction.

Formula: C₉H₁₀BrNO

Purity: Min. 95%

Molecular weight: 228.09 g/mol

Ref: 3D-QDA56176