CAS 90561-85-6
:2-Bromo-4-nitro-1,3,5-trimethylbenzene
Description:
2-Bromo-4-nitro-1,3,5-trimethylbenzene, with the CAS number 90561-85-6, is an aromatic compound characterized by the presence of a bromine atom and a nitro group attached to a trimethyl-substituted benzene ring. This compound features a bromine substituent at the second position and a nitro group at the fourth position of the benzene ring, while three methyl groups are located at the first, third, and fifth positions. The presence of these functional groups contributes to its chemical reactivity and physical properties. Typically, such compounds exhibit moderate solubility in organic solvents and may have limited solubility in water due to their hydrophobic nature. The nitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity in electrophilic aromatic substitution reactions. Additionally, the bromine atom can serve as a site for further chemical modifications. Overall, 2-Bromo-4-nitro-1,3,5-trimethylbenzene is of interest in various fields, including organic synthesis and materials science.
Formula:C9H10BrNO2
InChI:InChI=1/C9H10BrNO2/c1-5-4-6(2)9(11(12)13)7(3)8(5)10/h4H,1-3H3
SMILES:Cc1cc(C)c(c(C)c1Br)N(=O)=O
Synonyms:- 2-Bromo-4-nitromesitylene~3-Bromo-2,4,6-trimethylnitrobenzene
- 2-Bromo-1,3,5-Trimethyl-4-Nitrobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Bromo-1,3,5-trimethyl-4-nitrobenzene, 90+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C9H10BrNO2Purity:90+%Color and Shape:White to cream or pale yellow, Crystals or powder or crystalline powderMolecular weight:244.092-Bromo-1,3,5-trimethyl-4-nitrobenzene
CAS:Formula:C9H10BrNO2Purity:97%Color and Shape:SolidMolecular weight:244.08522-Bromo-1,3,5-Trimethyl-4-Nitrobenzene
CAS:2-Bromo-1,3,5-Trimethyl-4-NitrobenzenePurity:97%Molecular weight:244.09g/mol



