CymitQuimica logo

CAS 90562-55-3

:

Glycine, N-(3-chloro-o-tolyl)-

Description:
Glycine, N-(3-chloro-o-tolyl)-, also known by its CAS number 90562-55-3, is an organic compound that features a glycine backbone modified with a 3-chloro-o-tolyl group. This compound is characterized by its amino acid structure, which includes both an amino group (-NH2) and a carboxylic acid group (-COOH), making it a zwitterionic molecule at physiological pH. The presence of the 3-chloro-o-tolyl substituent introduces unique properties, such as potential biological activity and altered solubility compared to unmodified glycine. It may exhibit specific interactions with biological systems, potentially influencing its applications in pharmaceuticals or agrochemicals. The chlorinated aromatic ring can also contribute to the compound's stability and reactivity. As with many chemical substances, safety and handling precautions are essential, as the chlorinated derivatives may pose environmental and health risks. Overall, glycine derivatives like this compound are of interest in various fields, including medicinal chemistry and material science, due to their diverse functional properties.
Formula:C9H10ClNO2
InChI:InChI=1S/C9H10ClNO2/c1-6-7(10)3-2-4-8(6)11-5-9(12)13/h2-4,11H,5H2,1H3,(H,12,13)
InChI key:InChIKey=WXYMSKILUGMGFZ-UHFFFAOYSA-N
SMILES:N(CC(O)=O)C1=C(C)C(Cl)=CC=C1
Synonyms:
  • Glycine, N-(3-chloro-o-tolyl)-
  • 2-[(3-Chloro-2-methylphenyl)amino]acetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.