CAS 90563-93-2
:4-methyl-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid
Description:
4-Methyl-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid is a chemical compound characterized by its unique bicyclic structure, which includes a benzoxazine ring fused with a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the methyl group at the 4-position of the benzoxazine ring influences its solubility and polarity, making it more amenable to various chemical reactions. As a carboxylic acid, it can participate in acid-base reactions and may serve as a precursor or intermediate in organic synthesis. Additionally, compounds of this class are often studied for their potential applications in materials science, pharmaceuticals, and as intermediates in the synthesis of more complex organic molecules. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable chemical databases for precise applications.
Formula:C9H8NO3
InChI:InChI=1/C9H9NO3/c11-9(12)8-5-10-6-3-1-2-4-7(6)13-8/h1-4,8,10H,5H2,(H,11,12)/p-1/t8-/m1/s1
SMILES:c1ccc2c(c1)NC[C@H](C(=O)[O-])O2
Synonyms:- 3,4-dihydro-2H-1,4-benzoxazine-2-carboxylic acid
- (2S)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate
- (2R)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3,4-Dihydro-2H-benzo[b][1,4]oxazine-2-carboxylic acid
CAS:Formula:C9H9NO3Purity:97%Color and Shape:SolidMolecular weight:179.17273,4-Dihydro-2H-1,4-benzoxazine-2-carboxylic acid
CAS:3,4-Dihydro-2H-1,4-benzoxazine-2-carboxylic acid
Purity:95Molecular weight:179.17g/mol3,4-DIHYDRO-2H-1,4-BENZOXAZINE-2-CARBOXYLIC ACID
CAS:Formula:C9H9NO3Purity:97%Molecular weight:179.1753,4-Dihydro-2H-1,4-benzoxazine-2-carboxylic Acid
CAS:Controlled ProductFormula:C9H9NO3Color and Shape:NeatMolecular weight:179.1733,4-Dihydro-2H-1,4-benzoxazine-2-carboxylic acid
CAS:3,4-Dihydro-2H-1,4-benzoxazine-2-carboxylic acid is a chemical compound that is used in the synthesis of esters. It can be used to separate mixtures of compounds in liquid chromatography and reversed phase liquid chromatography. This chemical compound has been shown to have adrenolytic properties, which are due to its ability to modify the activity of the alpha and beta adrenergic receptors. 3,4-Dihydro-2H-1,4-benzoxazine-2-carboxylic acid inhibits lipogenesis by inhibiting enzymes that catalyze this process.Formula:C9H9NO3Purity:Min. 95%Molecular weight:179.17 g/mol




