CAS 90564-23-1
:5-ethyl-2-hydroxy-3-nitrobenzaldehyde
Description:
5-Ethyl-2-hydroxy-3-nitrobenzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group, a hydroxyl group, and a nitro group. The presence of the ethyl group at the 5-position and the hydroxyl group at the 2-position contributes to its unique reactivity and solubility properties. This compound typically exhibits a yellow to orange color in solid form and is soluble in organic solvents, such as ethanol and acetone, while being less soluble in water due to its hydrophobic ethyl group. The nitro group introduces electrophilic characteristics, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and reductions. Additionally, the hydroxyl group can participate in hydrogen bonding, influencing its physical properties and reactivity. This compound may find applications in organic synthesis, dye production, or as an intermediate in the manufacture of pharmaceuticals and agrochemicals. Safety data should be consulted for handling and storage, as nitro compounds can be sensitive to heat and shock.
Formula:C9H9NO4
InChI:InChI=1/C9H9NO4/c1-2-6-3-7(5-11)9(12)8(4-6)10(13)14/h3-5,12H,2H2,1H3
SMILES:CCc1cc(C=O)c(c(c1)N(=O)=O)O
Synonyms:- Benzaldehyde, 5-ethyl-2-hydroxy-3-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
