CAS 90564-27-5

3-Ethoxy-2-nitrobenzoic acid

Description:

3-Ethoxy-2-nitrobenzoic acid is an organic compound characterized by its aromatic structure, which includes a nitro group (-NO2) and an ethoxy group (-OCH2CH3) attached to a benzoic acid framework. The presence of the nitro group typically imparts significant polarity and can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitution. The ethoxy group enhances the solubility of the compound in organic solvents and can affect its overall stability and reactivity. As a benzoic acid derivative, it exhibits acidic properties, allowing it to participate in acid-base reactions. This compound may be utilized in organic synthesis, pharmaceuticals, or as an intermediate in the production of other chemical entities. Its specific physical properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the presence of functional groups. Safety data should be consulted for handling and usage, as nitro compounds can be sensitive and potentially hazardous.

Formula: C₉H₉NO₅

InChI: InChI=1S/C9H9NO5/c1-2-15-7-5-3-4-6(9(11)12)8(7)10(13)14/h3-5H,2H2,1H3,(H,11,12)

InChI key: InChIKey=ICJYGXUOVLGEIL-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(C(O)=O)C=CC=C1OCC

Synonyms:

• Benzoic acid, 3-ethoxy-2-nitro- (7CI)
• Benzoic acid, 3-ethoxy-2-nitro-
• 3-Ethoxy-2-nitrobenzoic acid