
CAS 90564-62-8
:2-Methyl-5-(1H-pyrazol-4-yl)pyridine
Description:
2-Methyl-5-(1H-pyrazol-4-yl)pyridine, with the CAS number 90564-62-8, is an organic compound that features a pyridine ring substituted with a methyl group and a pyrazole moiety. This compound typically exhibits a pale yellow to light brown solid appearance. It is characterized by its aromatic nature, which contributes to its stability and potential reactivity. The presence of both the pyridine and pyrazole rings suggests that it may engage in various interactions, such as hydrogen bonding and coordination with metal ions, making it of interest in coordination chemistry and medicinal chemistry. The compound may also exhibit biological activity, potentially serving as a scaffold for drug development. Its solubility can vary depending on the solvent, and it may be soluble in polar organic solvents. Overall, 2-Methyl-5-(1H-pyrazol-4-yl)pyridine is a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C9H9N3
InChI:InChI=1S/C9H9N3/c1-7-2-3-8(4-10-7)9-5-11-12-6-9/h2-6H,1H3,(H,11,12)
InChI key:InChIKey=CCWMQLKJFXJDKI-UHFFFAOYSA-N
SMILES:CC=1C=CC(=CN1)C=2C=NNC2
Synonyms:- Pyridine, 2-methyl-5-(1H-pyrazol-4-yl)-
- 2-Methyl-5-(1H-pyrazol-4-yl)pyridine
- 2-Picoline, 5-pyrazol-4-yl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.