
CAS 90565-28-9
:3-Ethyl-N,N-dimethyl-4-pyridinamine
Description:
3-Ethyl-N,N-dimethyl-4-pyridinamine, with the CAS number 90565-28-9, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an ethyl group and two dimethyl groups attached to the nitrogen atom, contributing to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the pyridine moiety imparts basicity to the compound, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Its solubility in polar solvents, such as water and alcohols, is notable, which can influence its applications in pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H14N2
InChI:InChI=1S/C9H14N2/c1-4-8-7-10-6-5-9(8)11(2)3/h5-7H,4H2,1-3H3
InChI key:InChIKey=FNRBJMADWMWFMZ-UHFFFAOYSA-N
SMILES:C(C)C=1C(N(C)C)=CC=NC1
Synonyms:- Pyridine, 4-(dimethylamino)-3-ethyl-
- 4-Pyridinamine, 3-ethyl-N,N-dimethyl-
- 3-Ethyl-N,N-dimethyl-4-pyridinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.