CymitQuimica logo

CAS 90565-33-6

:

α-[(1-Methylhydrazinyl)methyl]benzenemethanol

Description:
α-[(1-Methylhydrazinyl)methyl]benzenemethanol, with the CAS number 90565-33-6, is an organic compound characterized by the presence of a hydrazine functional group and a benzyl alcohol moiety. This compound features a methylhydrazine substituent attached to a benzyl alcohol structure, which contributes to its potential reactivity and biological activity. The presence of the hydrazine group suggests that it may participate in various chemical reactions, including oxidation and condensation reactions. Additionally, the compound may exhibit properties such as solubility in polar solvents due to the hydroxyl group of the benzyl alcohol. Its molecular structure may also imply potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, given the biological significance of hydrazine derivatives. However, specific safety and handling guidelines should be observed due to the potential toxicity associated with hydrazine compounds. Overall, α-[(1-Methylhydrazinyl)methyl]benzenemethanol is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C9H14N2O
InChI:InChI=1S/C9H14N2O/c1-11(10)7-9(12)8-5-3-2-4-6-8/h2-6,9,12H,7,10H2,1H3
InChI key:InChIKey=AZQFNDSMVBYRQK-UHFFFAOYSA-N
SMILES:C(CN(C)N)(O)C1=CC=CC=C1
Synonyms:
  • α-[(1-Methylhydrazinyl)methyl]benzenemethanol
  • Benzenemethanol, α-[(1-methylhydrazino)methyl]-
  • 2-(1-Methylhydrazino)-1-phenylethanol
  • Benzyl alcohol, α-[(1-methylhydrazino)methyl]-
  • Benzenemethanol, α-[(1-methylhydrazinyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.