
CAS 90565-54-1
:5,6-Dimethyl-2-propyl-4(3H)-pyrimidinone
Description:
5,6-Dimethyl-2-propyl-4(3H)-pyrimidinone, identified by its CAS number 90565-54-1, is a heterocyclic organic compound belonging to the pyrimidine family. This compound features a pyrimidinone ring, which is characterized by a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3, along with a carbonyl group at position 4. The presence of two methyl groups at positions 5 and 6, and a propyl group at position 2, contributes to its unique structural and chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its functional groups suggest potential reactivity, making it of interest in various chemical syntheses and applications, particularly in pharmaceuticals and agrochemicals. The specific arrangement of substituents can influence its biological activity and interaction with other molecules, which is a key area of research in medicinal chemistry. Overall, 5,6-Dimethyl-2-propyl-4(3H)-pyrimidinone is a compound with notable structural features that may lend itself to diverse applications in chemical research.
Formula:C9H14N2O
InChI:InChI=1S/C9H14N2O/c1-4-5-8-10-7(3)6(2)9(12)11-8/h4-5H2,1-3H3,(H,10,11,12)
InChI key:InChIKey=OMOINPCFCMSASJ-UHFFFAOYSA-N
SMILES:C(CC)C=1NC(C)=C(C)C(=O)N1
Synonyms:- 4(3H)-Pyrimidinone, 5,6-dimethyl-2-propyl-
- 5,6-Dimethyl-2-propyl-4(3H)-pyrimidinone
- 4(1H)-Pyrimidinone, 5,6-dimethyl-2-propyl-
- 5,6-Dimethyl-2-propyl-4(1H)-pyrimidinone
- 4-Pyrimidinol, 5,6-dimethyl-2-propyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.