CAS 90566-23-7

3-Amino-4-(1-methylethoxy)benzenesulfonamide

Description:

3-Amino-4-(1-methylethoxy)benzenesulfonamide, identified by its CAS number 90566-23-7, is an organic compound characterized by the presence of an amino group and a sulfonamide functional group attached to a benzene ring. This compound features a methylethoxy substituent, which contributes to its unique chemical properties. The sulfonamide group is known for its ability to form hydrogen bonds, enhancing the compound's solubility in polar solvents. The amino group can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a versatile building block in organic synthesis. Additionally, the presence of the methylethoxy group may influence the compound's lipophilicity and biological activity. Such compounds often exhibit potential pharmaceutical applications, particularly in the development of antimicrobial agents or as intermediates in the synthesis of more complex molecules. Overall, 3-Amino-4-(1-methylethoxy)benzenesulfonamide is a significant compound in medicinal chemistry and organic synthesis due to its functional groups and structural characteristics.

Formula: C₉H₁₄N₂O₃S

InChI: InChI=1S/C9H14N2O3S/c1-6(2)14-9-4-3-7(5-8(9)10)15(11,12)13/h3-6H,10H2,1-2H3,(H2,11,12,13)

InChI key: InChIKey=UNZNLLIRZYWTEV-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=CC(N)=C(OC(C)C)C=C1

Synonyms:

• 3-Amino-4-(propan-2-yloxy)benzene-1-sulfonamide
• Benzenesulfonamide, 3-amino-4-(1-methylethoxy)-
• 3-Amino-4-isopropoxybenzenesulfonamide
• Metanilamide, 4-isopropoxy-
• 3-Amino-4-(1-methylethoxy)benzenesulfonamide