CymitQuimica logo

CAS 90566-57-7

:

5,8-Diazaspiro[3.5]nonane

Description:
5,8-Diazaspiro[3.5]nonane is a bicyclic organic compound characterized by its unique spiro structure, which consists of two nitrogen atoms incorporated into a nonane framework. This compound features a spiro connection between a five-membered and a seven-membered ring, contributing to its distinctive three-dimensional shape. The presence of nitrogen atoms in the rings can influence its chemical reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound is typically colorless to pale yellow and may exhibit basic properties due to the nitrogen atoms. Its molecular structure allows for various conformations, which can affect its interactions with biological targets. Additionally, 5,8-Diazaspiro[3.5]nonane may be of interest in the study of molecular recognition and supramolecular chemistry due to its unique spatial arrangement. As with many nitrogen-containing heterocycles, it may also participate in hydrogen bonding and other non-covalent interactions, making it a valuable compound for research in organic synthesis and drug design.
Formula:C7H14N2
InChI:InChI=1S/C7H14N2/c1-2-7(3-1)6-8-4-5-9-7/h8-9H,1-6H2
InChI key:InChIKey=GGRDXGCQBQZPNZ-UHFFFAOYSA-N
SMILES:C12(CCC1)CNCCN2
Synonyms:
  • 5,8-Diazaspiro[3.5]nonane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.