CymitQuimica logo

CAS 90567-45-6

:

Pyrazole-3(or 5)-carboxylic acid, 5(or 3)-borono-

Description:
Pyrazole-3(or 5)-carboxylic acid, 5(or 3)-borono- is a chemical compound characterized by the presence of both a pyrazole ring and a boronic acid functional group. The pyrazole moiety contributes to its potential reactivity and biological activity, while the boronic acid group is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and materials science. The compound typically exhibits moderate solubility in polar solvents due to the presence of the carboxylic acid group, which can also participate in hydrogen bonding. Its structural isomerism, indicated by the "3(or 5)" and "5(or 3)" in the name, suggests that the compound can exist in different forms depending on the position of the carboxylic acid and boronic acid groups on the pyrazole ring. This versatility may lead to varied reactivity and interactions in chemical reactions, making it a subject of interest in research and development.
Formula:C4H5BN2O4
InChI:InChI=1S/C4H5BN2O4/c8-4(9)2-1-3(5(10)11)7-6-2/h1,10-11H,(H,6,7)(H,8,9)
InChI key:InChIKey=GUYCLYJWXICSGN-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CC(C(O)=O)=NN1
Synonyms:
  • Pyrazole-3(or 5)-carboxylic acid, 5(or 3)-borono-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.