CymitQuimica logo

CAS 905710-77-2

:

1,3-Dihydro-1-hydroxy-2,1-benzoxaborole-5-methanol

Description:
1,3-Dihydro-1-hydroxy-2,1-benzoxaborole-5-methanol, with the CAS number 905710-77-2, is a boron-containing organic compound characterized by its unique structural features, including a benzoxaborole framework. This compound typically exhibits a bicyclic structure that incorporates a boron atom, which contributes to its reactivity and potential applications in medicinal chemistry. The presence of hydroxyl and methanol functional groups enhances its solubility and may influence its biological activity. 1,3-Dihydro-1-hydroxy-2,1-benzoxaborole derivatives have garnered interest for their potential use as antifungal agents, particularly due to their ability to inhibit specific enzymes involved in fungal cell wall synthesis. Additionally, the compound's boron atom can participate in various coordination and bonding interactions, making it a versatile candidate for further chemical modifications. Overall, this substance represents a significant area of research in the development of new therapeutic agents, particularly in the fight against resistant fungal infections.
Formula:C8H9BO3
InChI:InChI=1S/C8H9BO3/c10-4-6-1-2-8-7(3-6)5-12-9(8)11/h1-3,10-11H,4-5H2
InChI key:InChIKey=ZBVCPDWREFJZOJ-UHFFFAOYSA-N
SMILES:OB1C=2C(=CC(CO)=CC2)CO1
Synonyms:
  • 2,1-Benzoxaborole-5-methanol, 1,3-dihydro-1-hydroxy-
  • 1,3-Dihydro-1-hydroxy-2,1-benzoxaborole-5-methanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.