CymitQuimica logo

CAS 905797-71-9

:

2-bromo-N-(4-fluorophenyl)propanamide

Description:
2-Bromo-N-(4-fluorophenyl)propanamide is an organic compound characterized by its amide functional group, which is derived from propanoic acid. The presence of a bromine atom and a fluorine atom in its structure contributes to its unique chemical properties and potential reactivity. This compound features a propanamide backbone with a bromine substituent at the second carbon and a 4-fluorophenyl group attached to the nitrogen atom. The fluorine atom can enhance the compound's lipophilicity and influence its biological activity, making it of interest in pharmaceutical research. Additionally, the bromine atom may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The compound's molecular structure suggests it may exhibit specific interactions with biological targets, which could be explored for therapeutic applications. Overall, 2-bromo-N-(4-fluorophenyl)propanamide is a compound of interest in organic synthesis and medicinal chemistry due to its halogenated nature and potential biological implications.
Formula:C9H9BrFNO
InChI:InChI=1/C9H9BrFNO/c1-6(10)9(13)12-8-4-2-7(11)3-5-8/h2-6H,1H3,(H,12,13)
SMILES:CC(C(=O)Nc1ccc(cc1)F)Br
Synonyms:
  • propanamide, 2-bromo-N-(4-fluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.