CAS 905809-10-1
:5-Methyl-4-(phenoxymethyl)-3-isoxazolecarboxylic acid
Description:
5-Methyl-4-(phenoxymethyl)-3-isoxazolecarboxylic acid is a chemical compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of a methyl group and a phenoxymethyl substituent enhances its molecular complexity and may influence its biological activity and solubility. Typically, compounds like this can exhibit various pharmacological properties, making them of interest in medicinal chemistry. The isoxazole moiety is often associated with diverse biological activities, including anti-inflammatory and antimicrobial effects. Additionally, the compound's structure suggests potential for interactions with biological targets, which could be explored in drug development. Its CAS number, 905809-10-1, allows for precise identification in chemical databases and literature. Overall, 5-Methyl-4-(phenoxymethyl)-3-isoxazolecarboxylic acid represents a unique structure that may have significant implications in research and application within the field of chemistry and pharmaceuticals.
Formula:C12H11NO4
InChI:InChI=1S/C12H11NO4/c1-8-10(11(12(14)15)13-17-8)7-16-9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,14,15)
InChI key:InChIKey=ANYZXRACRRTPTD-UHFFFAOYSA-N
SMILES:C(OC1=CC=CC=C1)C=2C(C(O)=O)=NOC2C
Synonyms:- 5-Methyl-4-(phenoxymethyl)-3-isoxazolecarboxylic acid
- 3-Isoxazolecarboxylic acid, 5-methyl-4-(phenoxymethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.