CAS 905810-26-6

3-[(3-chloro-4-fluorophenyl)amino]-3-oxopropanoic acid

Description:

3-[(3-chloro-4-fluorophenyl)amino]-3-oxopropanoic acid, identified by its CAS number 905810-26-6, is a chemical compound characterized by its unique structure that includes an amino group, a chloro and fluorine substituent on a phenyl ring, and a keto acid functional group. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, which can influence its solubility, reactivity, and potential biological activity. The presence of the chloro and fluorine atoms can enhance lipophilicity and may affect the compound's interaction with biological targets. As a keto acid, it may participate in various chemical reactions, including decarboxylation and condensation. The compound's specific characteristics, such as melting point, boiling point, and spectral properties, would depend on its purity and the conditions under which it is studied. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological systems.

Formula: C₉H₇ClFNO₃

InChI: InChI=1/C9H7ClFNO3/c10-6-3-5(1-2-7(6)11)12-8(13)4-9(14)15/h1-3H,4H2,(H,12,13)(H,14,15)

SMILES: c1cc(c(cc1N=C(CC(=O)O)O)Cl)F

Synonyms:

• Propanoic acid, 3-[(3-chloro-4-fluorophenyl)amino]-3-oxo-
• 3-[(3-Chloro-4-fluorophenyl)amino]-3-oxopropanoic acid