CAS 905811-01-0

2-bromo-N-cyclopentylbutanamide

Description:

2-bromo-N-cyclopentylbutanamide is a chemical compound characterized by its amide functional group, which is derived from butanoic acid and features a cyclopentyl group attached to the nitrogen atom. The presence of the bromine atom at the second position of the butanamide chain introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. This compound is likely to exhibit moderate polarity due to the amide bond, influencing its solubility in polar solvents. The cyclopentyl group contributes to the compound's steric properties, potentially affecting its biological activity and interaction with other molecules. As with many brominated compounds, it may also exhibit unique properties in terms of stability and reactivity under different conditions. Overall, 2-bromo-N-cyclopentylbutanamide is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.

Formula: C₉H₁₆BrNO

InChI: InChI=1/C9H16BrNO/c1-2-8(10)9(12)11-7-5-3-4-6-7/h7-8H,2-6H2,1H3,(H,11,12)

SMILES: CCC(C(=NC1CCCC1)O)Br

Synonyms:

• Butanamide, 2-bromo-N-cyclopentyl-