CAS 905811-02-1
:3-Amino-4-chloro-N,N-diethylbenzamide
Description:
3-Amino-4-chloro-N,N-diethylbenzamide is an organic compound characterized by its amide functional group, which is derived from benzoic acid. The presence of the amino group (-NH2) and the chloro substituent (-Cl) on the benzene ring contributes to its reactivity and potential biological activity. The diethyl groups attached to the nitrogen atom enhance its lipophilicity, which may influence its solubility and permeability in biological systems. This compound may exhibit properties typical of amides, such as moderate polarity and the ability to participate in hydrogen bonding. Its structure suggests potential applications in pharmaceuticals or agrochemicals, where modifications to the benzamide framework can lead to varied biological activities. Additionally, the chlorine atom can introduce unique electronic effects, potentially affecting the compound's reactivity and interaction with biological targets. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of chlorine and the potential for biological activity.
Formula:C11H15ClN2O
InChI:InChI=1/C11H15ClN2O/c1-3-14(4-2)11(15)8-5-6-9(12)10(13)7-8/h5-7H,3-4,13H2,1-2H3
InChI key:InChIKey=UEVFJJAHTBFKAO-UHFFFAOYSA-N
SMILES:C(N(CC)CC)(=O)C1=CC(N)=C(Cl)C=C1
Synonyms:- Benzamide, 3-amino-4-chloro-N,N-diethyl-
- 3-Amino-4-chloro-N,N-diethylbenzamide
- AKOS BBV-011744
- UKRORGSYN-BB BBV-011744
- 3-amino-4-chloro-N,N-diethylbenzamide(SALTDATA: FREE)
- OTAVA-BB 1133902
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
